C42H34Cl4O8 — CID 141296631
[2,3,4-tris[[2-(2-chlorophenyl)acetyl]oxymethyl]phenyl]methyl 2-(2-chlorophenyl)acetate (PubChem CID 141296631) has the molecular formula C42H34Cl4O8 and a molecular weight of 808.54 g/mol. Its IUPAC name is [2,3,4-tris[[2-(2-chlorophenyl)acetyl]oxymethyl]phenyl]methyl 2-(2-chlorophenyl)acetate.
| Compound Name | [2,3,4-tris[[2-(2-chlorophenyl)acetyl]oxymethyl]phenyl]methyl 2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 141296631 |
| Molecular Formula | C42H34Cl4O8 |
| Molecular Weight | 808.54 g/mol |
| Exact Mass | 806.10 |
| IUPAC Name | [2,3,4-tris[[2-(2-chlorophenyl)acetyl]oxymethyl]phenyl]methyl 2-(2-chlorophenyl)acetate |
| SMILES | O=C(Cc1ccccc1Cl)OCc1ccc(COC(=O)Cc2ccccc2Cl)c(COC(=O)Cc2ccccc2Cl)c1COC(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C42H34Cl4O8/c43-35-13-5-1-9-27(35)19-39(47)51-23-31-17-18-32(24-52-40(48)20-28-10-2-6-14-36(28)44)34(26-54-42(50)22-30-12-4-8-16-38(30)46)33(31)25-53-41(49)21-29-11-3-7-15-37(29)45/h1-18H,19-26H2 |
| InChIKey | PYGBGXONGJTSMA-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.54 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|