About (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate
(2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate (PubChem CID 61278448) has the molecular formula C13H16ClNO2
and a molecular weight of 253.73 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate |
| PubChem CID | 61278448 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate |
| SMILES | NC1(C(=O)OCc2ccccc2Cl)CCCC1 |
| InChI | InChI=1S/C13H16ClNO2/c14-11-6-2-1-5-10(11)9-17-12(16)13(15)7-3-4-8-13/h1-2,5-6H,3-4,7-9,15H2 |
| InChIKey | BDQDTFIIMNAGFI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate?
The IUPAC name of (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate (CID 61278448) is (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate.
What is the SMILES notation for (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate?
The canonical SMILES for (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate is NC1(C(=O)OCc2ccccc2Cl)CCCC1.
What is the InChIKey of (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate?
The InChIKey is BDQDTFIIMNAGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO2/c14-11-6-2-1-5-10(11)9-17-12(16)13(15)7-3-4-8-13/h1-2,5-6H,3-4,7-9,15H2.
What are the key properties of (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate?
(2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate has a molecular weight of 253.73 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate is sourced from PubChem (CID 61278448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).