2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid

C13H15ClO3 — CID 103272478

IUPAC2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid
SMILESO=C(O)CC1(OCc2ccccc2Cl)CCC1
InChIInChI=1S/C13H15ClO3/c14-11-5-2-1-4-10(11)9-17-13(6-3-7-13)8-12(15)16/h1-2,4-5H,3,6-9H2,(H,15,16)
InChIKeyNLDRVDFCEGUPDN-UHFFFAOYSA-N
MW254.71 g/mol
LogP3.25
Rot. Bonds5

About 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid

2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid (PubChem CID 103272478) has the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. Its IUPAC name is 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid.

Molecular Properties

Compound Name2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid
PubChem CID103272478
Molecular FormulaC13H15ClO3
Molecular Weight254.71 g/mol
Exact Mass254.07
IUPAC Name2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid
SMILESO=C(O)CC1(OCc2ccccc2Cl)CCC1
InChIInChI=1S/C13H15ClO3/c14-11-5-2-1-4-10(11)9-17-13(6-3-7-13)8-12(15)16/h1-2,4-5H,3,6-9H2,(H,15,16)
InChIKeyNLDRVDFCEGUPDN-UHFFFAOYSA-N
XLogP3.25
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.71
LogP ≤ 53.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[1-(2-ethylphenoxy)cyclobutyl]acetic acid
CID 103272592
N-[[1-[(2-chlorophenyl)methoxy]cyclopentyl]methyl]propan-1-amine
CID 62105997
(2-chlorophenyl)methyl 1-aminocyclopentane-1-carboxylate
CID 61278448
[1-[(2-chlorophenyl)methoxy]-3-methylcyclohexyl]methanamine
CID 62109260
methyl 2-[1-[(2-bromophenyl)methoxy]cyclobutyl]acetate
CID 103272835
2-[1-[(2-chlorophenyl)methyl-methylamino]cyclohexyl]acetic acid
CID 65242660
2-[1-(2-chloro-4-methylphenoxy)cyclobutyl]acetic acid
CID 103272730
sodium;2-(2-chlorophenyl)acetic acid;hydride
CID 174699179
2-(2-chlorophenyl)-1-(1-phenylcyclopropyl)ethanone
CID 62881925
2-[1-(2-phenylphenoxy)cyclobutyl]acetic acid
CID 103272411
2-[1-(2-chloro-5-nitrophenoxy)cyclobutyl]acetic acid
CID 103272753
2-[2-[(2-chlorophenoxy)methyl]phenyl]acetic acid
CID 22366404

Frequently Asked Questions

What is the IUPAC name of 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid?
The IUPAC name of 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid (CID 103272478) is 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid.
What is the SMILES notation for 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid?
The canonical SMILES for 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid is O=C(O)CC1(OCc2ccccc2Cl)CCC1.
What is the InChIKey of 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid?
The InChIKey is NLDRVDFCEGUPDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO3/c14-11-5-2-1-4-10(11)9-17-13(6-3-7-13)8-12(15)16/h1-2,4-5H,3,6-9H2,(H,15,16).
What are the key properties of 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid?
2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid has a molecular weight of 254.71 g/mol, XLogP of 3.25, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2-chlorophenyl)methoxy]cyclobutyl]acetic acid is sourced from PubChem (CID 103272478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).