About (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate
(2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (PubChem CID 52600368) has the molecular formula C13H16ClNO4S
and a molecular weight of 317.79 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
Analyze (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The IUPAC name of (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (CID 52600368) is (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
What is the SMILES notation for (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The canonical SMILES for (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate is O=C(CN1CCS(=O)(=O)CC1)OCc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The InChIKey is JYFMARHLDGIDKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO4S/c14-12-4-2-1-3-11(12)10-19-13(16)9-15-5-7-20(17,18)8-6-15/h1-4H,5-10H2.
What are the key properties of (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
(2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate has a molecular weight of 317.79 g/mol, XLogP of 1.11, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate is sourced from PubChem (CID 52600368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).