C15H19NO4S — CID 91939030
3-phenylprop-2-enyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (PubChem CID 91939030) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
| Compound Name | 3-phenylprop-2-enyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate |
|---|---|
| PubChem CID | 91939030 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-phenylprop-2-enyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate |
| SMILES | O=C(CN1CCS(=O)(=O)CC1)OCC=Cc1ccccc1 |
| InChI | InChI=1S/C15H19NO4S/c17-15(13-16-8-11-21(18,19)12-9-16)20-10-4-7-14-5-2-1-3-6-14/h1-7H,8-13H2 |
| InChIKey | LHLACIVGXBSMGF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |