C12H15NO2S — CID 58283179
4-[(E)-2-phenylethenyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 58283179) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-[(E)-2-phenylethenyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[(E)-2-phenylethenyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 58283179 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-[(E)-2-phenylethenyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C12H15NO2S/c14-16(15)10-8-13(9-11-16)7-6-12-4-2-1-3-5-12/h1-7H,8-11H2/b7-6+ |
| InChIKey | IGBAQDXBJVQERG-VOTSOKGWSA-N |
| XLogP | 1.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |