C16H25ClN4O2S — CID 111882929
1-[2-(2-chlorophenyl)ethyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine (PubChem CID 111882929) has the molecular formula C16H25ClN4O2S and a molecular weight of 372.92 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111882929 |
| Molecular Formula | C16H25ClN4O2S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccccc1Cl)NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H25ClN4O2S/c1-18-16(19-7-6-14-4-2-3-5-15(14)17)20-8-9-21-10-12-24(22,23)13-11-21/h2-5H,6-13H2,1H3,(H2,18,19,20) |
| InChIKey | MPJOAVCLDPLIJT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|