C18H30N4O3S — CID 111588797
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[2-(3-methoxy-4-methylphenyl)ethyl]-2-methylguanidine (PubChem CID 111588797) has the molecular formula C18H30N4O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[2-(3-methoxy-4-methylphenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[2-(3-methoxy-4-methylphenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111588797 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[2-(3-methoxy-4-methylphenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1ccc(C)c(OC)c1)NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C18H30N4O3S/c1-15-4-5-16(14-17(15)25-3)6-7-20-18(19-2)21-8-9-22-10-12-26(23,24)13-11-22/h4-5,14H,6-13H2,1-3H3,(H2,19,20,21) |
| InChIKey | FQHMUXFEUCQRHW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|