C33H30Cl2N2O5 — CID 150050090
dibenzyl (2S)-2-[N-acetyl-2-(2,6-dichloroanilino)anilino]pentanedioate (PubChem CID 150050090) has the molecular formula C33H30Cl2N2O5 and a molecular weight of 605.52 g/mol. Its IUPAC name is dibenzyl (2S)-2-[N-acetyl-2-(2,6-dichloroanilino)anilino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[N-acetyl-2-(2,6-dichloroanilino)anilino]pentanedioate |
|---|---|
| PubChem CID | 150050090 |
| Molecular Formula | C33H30Cl2N2O5 |
| Molecular Weight | 605.52 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | dibenzyl (2S)-2-[N-acetyl-2-(2,6-dichloroanilino)anilino]pentanedioate |
| SMILES | CC(=O)N(c1ccccc1Nc1c(Cl)cccc1Cl)[C@@H](CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H30Cl2N2O5/c1-23(38)37(29-18-9-8-17-28(29)36-32-26(34)15-10-16-27(32)35)30(33(40)42-22-25-13-6-3-7-14-25)19-20-31(39)41-21-24-11-4-2-5-12-24/h2-18,30,36H,19-22H2,1H3/t30-/m0/s1 |
| InChIKey | DLDAKGLGGNPPJJ-PMERELPUSA-N |
| XLogP | 7.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.52 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |