C14H11Cl2N5 — CID 154110060
2,6-dichloro-N-[2-(2H-tetrazol-5-ylmethyl)phenyl]aniline (PubChem CID 154110060) has the molecular formula C14H11Cl2N5 and a molecular weight of 320.18 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-(2H-tetrazol-5-ylmethyl)phenyl]aniline.
| Compound Name | 2,6-dichloro-N-[2-(2H-tetrazol-5-ylmethyl)phenyl]aniline |
|---|---|
| PubChem CID | 154110060 |
| Molecular Formula | C14H11Cl2N5 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2,6-dichloro-N-[2-(2H-tetrazol-5-ylmethyl)phenyl]aniline |
| SMILES | Clc1cccc(Cl)c1Nc1ccccc1Cc1nn[nH]n1 |
| InChI | InChI=1S/C14H11Cl2N5/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13-18-20-21-19-13/h1-7,17H,8H2,(H,18,19,20,21) |
| InChIKey | HRXTZFGGIQJVTH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |