C7H5Cl2N5 — CID 69263868
N-(2,3-dichlorophenyl)-2H-tetrazol-5-amine (PubChem CID 69263868) has the molecular formula C7H5Cl2N5 and a molecular weight of 230.06 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2H-tetrazol-5-amine.
| Compound Name | N-(2,3-dichlorophenyl)-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 69263868 |
| Molecular Formula | C7H5Cl2N5 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2H-tetrazol-5-amine |
| SMILES | Clc1cccc(Nc2nn[nH]n2)c1Cl |
| InChI | InChI=1S/C7H5Cl2N5/c8-4-2-1-3-5(6(4)9)10-7-11-13-14-12-7/h1-3H,(H2,10,11,12,13,14) |
| InChIKey | USZBBWUHAOUMNZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |