C8H7Cl2N5 — CID 4725567
N-[(2,3-dichlorophenyl)methyl]-2H-tetrazol-5-amine (PubChem CID 4725567) has the molecular formula C8H7Cl2N5 and a molecular weight of 244.09 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 4725567 |
| Molecular Formula | C8H7Cl2N5 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-2H-tetrazol-5-amine |
| SMILES | Clc1cccc(CNc2nn[nH]n2)c1Cl |
| InChI | InChI=1S/C8H7Cl2N5/c9-6-3-1-2-5(7(6)10)4-11-8-12-14-15-13-8/h1-3H,4H2,(H2,11,12,13,14,15) |
| InChIKey | QTYGOGDNFJVRFE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |