C8H10N6 — CID 131070932
N-[(2-methyl-3-pyridinyl)methyl]-2H-tetrazol-5-amine (PubChem CID 131070932) has the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. Its IUPAC name is N-[(2-methyl-3-pyridinyl)methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[(2-methyl-3-pyridinyl)methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 131070932 |
| Molecular Formula | C8H10N6 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | N-[(2-methyl-3-pyridinyl)methyl]-2H-tetrazol-5-amine |
| SMILES | Cc1ncccc1CNc1nn[nH]n1 |
| InChI | InChI=1S/C8H10N6/c1-6-7(3-2-4-9-6)5-10-8-11-13-14-12-8/h2-4H,5H2,1H3,(H2,10,11,12,13,14) |
| InChIKey | DLINGGDJZBNBKR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |