C9H8F3N5 — CID 4726734
N-[[2-(trifluoromethyl)phenyl]methyl]-2H-tetrazol-5-amine (PubChem CID 4726734) has the molecular formula C9H8F3N5 and a molecular weight of 243.19 g/mol. Its IUPAC name is N-[[2-(trifluoromethyl)phenyl]methyl]-2H-tetrazol-5-amine.
| Compound Name | N-[[2-(trifluoromethyl)phenyl]methyl]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 4726734 |
| Molecular Formula | C9H8F3N5 |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-[[2-(trifluoromethyl)phenyl]methyl]-2H-tetrazol-5-amine |
| SMILES | FC(F)(F)c1ccccc1CNc1nn[nH]n1 |
| InChI | InChI=1S/C9H8F3N5/c10-9(11,12)7-4-2-1-3-6(7)5-13-8-14-16-17-15-8/h1-4H,5H2,(H2,13,14,15,16,17) |
| InChIKey | PODSOZRFVRUDMM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |