C18H16Cl2N2O — CID 122186007
[4-[(2,3-dichlorophenyl)methylamino]-2-methylquinolin-8-yl]methanol (PubChem CID 122186007) has the molecular formula C18H16Cl2N2O and a molecular weight of 347.25 g/mol. Its IUPAC name is [4-[(2,3-dichlorophenyl)methylamino]-2-methylquinolin-8-yl]methanol.
| Compound Name | [4-[(2,3-dichlorophenyl)methylamino]-2-methylquinolin-8-yl]methanol |
|---|---|
| PubChem CID | 122186007 |
| Molecular Formula | C18H16Cl2N2O |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | [4-[(2,3-dichlorophenyl)methylamino]-2-methylquinolin-8-yl]methanol |
| SMILES | Cc1cc(NCc2cccc(Cl)c2Cl)c2cccc(CO)c2n1 |
| InChI | InChI=1S/C18H16Cl2N2O/c1-11-8-16(14-6-2-5-13(10-23)18(14)22-11)21-9-12-4-3-7-15(19)17(12)20/h2-8,23H,9-10H2,1H3,(H,21,22) |
| InChIKey | YEJIRLMMTYBILN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |