C24H19Cl2N3O — CID 59474775
N-[4-[(3,4-dichlorophenyl)methylamino]-2-methylquinolin-8-yl]benzamide (PubChem CID 59474775) has the molecular formula C24H19Cl2N3O and a molecular weight of 436.34 g/mol. Its IUPAC name is N-[4-[(3,4-dichlorophenyl)methylamino]-2-methylquinolin-8-yl]benzamide.
| Compound Name | N-[4-[(3,4-dichlorophenyl)methylamino]-2-methylquinolin-8-yl]benzamide |
|---|---|
| PubChem CID | 59474775 |
| Molecular Formula | C24H19Cl2N3O |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-[4-[(3,4-dichlorophenyl)methylamino]-2-methylquinolin-8-yl]benzamide |
| SMILES | Cc1cc(NCc2ccc(Cl)c(Cl)c2)c2cccc(NC(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C24H19Cl2N3O/c1-15-12-22(27-14-16-10-11-19(25)20(26)13-16)18-8-5-9-21(23(18)28-15)29-24(30)17-6-3-2-4-7-17/h2-13H,14H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | XWSPWUHJDGOGIZ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |