C24H23Cl2NO — CID 59121264
4-[3-(3,4-dichlorophenyl)-2-methylpropyl]-N-(2-methylphenyl)benzamide (PubChem CID 59121264) has the molecular formula C24H23Cl2NO and a molecular weight of 412.36 g/mol. Its IUPAC name is 4-[3-(3,4-dichlorophenyl)-2-methylpropyl]-N-(2-methylphenyl)benzamide.
| Compound Name | 4-[3-(3,4-dichlorophenyl)-2-methylpropyl]-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 59121264 |
| Molecular Formula | C24H23Cl2NO |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 4-[3-(3,4-dichlorophenyl)-2-methylpropyl]-N-(2-methylphenyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)c1ccc(CC(C)Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H23Cl2NO/c1-16(14-19-9-12-21(25)22(26)15-19)13-18-7-10-20(11-8-18)24(28)27-23-6-4-3-5-17(23)2/h3-12,15-16H,13-14H2,1-2H3,(H,27,28) |
| InChIKey | NPAFEQSJUMTRGA-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |