C24H21Cl2NO — CID 72522754
4-[4-(3,4-dichlorophenyl)but-2-en-2-yl]-N-(2-methylphenyl)benzamide (PubChem CID 72522754) has the molecular formula C24H21Cl2NO and a molecular weight of 410.34 g/mol. Its IUPAC name is 4-[4-(3,4-dichlorophenyl)but-2-en-2-yl]-N-(2-methylphenyl)benzamide.
| Compound Name | 4-[4-(3,4-dichlorophenyl)but-2-en-2-yl]-N-(2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 72522754 |
| Molecular Formula | C24H21Cl2NO |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 4-[4-(3,4-dichlorophenyl)but-2-en-2-yl]-N-(2-methylphenyl)benzamide |
| SMILES | CC(=CCc1ccc(Cl)c(Cl)c1)c1ccc(C(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C24H21Cl2NO/c1-16(7-8-18-9-14-21(25)22(26)15-18)19-10-12-20(13-11-19)24(28)27-23-6-4-3-5-17(23)2/h3-7,9-15H,8H2,1-2H3,(H,27,28) |
| InChIKey | GFWKKQTWNFZHAN-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |