C22H25Cl2NO — CID 54349510
4-[3-(3,4-dichlorophenyl)but-2-enyl]-N-(3-methylbutan-2-yl)benzamide (PubChem CID 54349510) has the molecular formula C22H25Cl2NO and a molecular weight of 390.35 g/mol. Its IUPAC name is 4-[3-(3,4-dichlorophenyl)but-2-enyl]-N-(3-methylbutan-2-yl)benzamide.
| Compound Name | 4-[3-(3,4-dichlorophenyl)but-2-enyl]-N-(3-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 54349510 |
| Molecular Formula | C22H25Cl2NO |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-[3-(3,4-dichlorophenyl)but-2-enyl]-N-(3-methylbutan-2-yl)benzamide |
| SMILES | CC(=CCc1ccc(C(=O)NC(C)C(C)C)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2NO/c1-14(2)16(4)25-22(26)18-9-7-17(8-10-18)6-5-15(3)19-11-12-20(23)21(24)13-19/h5,7-14,16H,6H2,1-4H3,(H,25,26) |
| InChIKey | UESXJTFVFBKGFI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |