C22H19ClN2O2 — CID 7312019
4-chloro-N-(2-methylphenyl)-3-[(2-phenylacetyl)amino]benzamide (PubChem CID 7312019) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is 4-chloro-N-(2-methylphenyl)-3-[(2-phenylacetyl)amino]benzamide.
| Compound Name | 4-chloro-N-(2-methylphenyl)-3-[(2-phenylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 7312019 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-chloro-N-(2-methylphenyl)-3-[(2-phenylacetyl)amino]benzamide |
| SMILES | Cc1ccccc1NC(=O)c1ccc(Cl)c(NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H19ClN2O2/c1-15-7-5-6-10-19(15)25-22(27)17-11-12-18(23)20(14-17)24-21(26)13-16-8-3-2-4-9-16/h2-12,14H,13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | BIQFFSNUBXJWMT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |