C19H19N3O — CID 122185951
2-methyl-4-[(4-methylphenyl)methylamino]quinoline-8-carboxamide (PubChem CID 122185951) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-methyl-4-[(4-methylphenyl)methylamino]quinoline-8-carboxamide.
| Compound Name | 2-methyl-4-[(4-methylphenyl)methylamino]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 122185951 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-methyl-4-[(4-methylphenyl)methylamino]quinoline-8-carboxamide |
| SMILES | Cc1ccc(CNc2cc(C)nc3c(C(N)=O)cccc23)cc1 |
| InChI | InChI=1S/C19H19N3O/c1-12-6-8-14(9-7-12)11-21-17-10-13(2)22-18-15(17)4-3-5-16(18)19(20)23/h3-10H,11H2,1-2H3,(H2,20,23)(H,21,22) |
| InChIKey | LCRSSRDNSNVWNN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |