C28H28N2O2 — CID 67912201
butyl 2-[4-[[(2-methylquinolin-4-yl)amino]methyl]phenyl]benzoate (PubChem CID 67912201) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is butyl 2-[4-[[(2-methylquinolin-4-yl)amino]methyl]phenyl]benzoate.
| Compound Name | butyl 2-[4-[[(2-methylquinolin-4-yl)amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 67912201 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | butyl 2-[4-[[(2-methylquinolin-4-yl)amino]methyl]phenyl]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1-c1ccc(CNc2cc(C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C28H28N2O2/c1-3-4-17-32-28(31)24-10-6-5-9-23(24)22-15-13-21(14-16-22)19-29-27-18-20(2)30-26-12-8-7-11-25(26)27/h5-16,18H,3-4,17,19H2,1-2H3,(H,29,30) |
| InChIKey | RVAQWYUBZAUJQT-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|