C26H26N4O2 — CID 19779310
2-[4-[[[2-(butylamino)quinazolin-4-yl]amino]methyl]phenyl]benzoic acid (PubChem CID 19779310) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[4-[[[2-(butylamino)quinazolin-4-yl]amino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[[2-(butylamino)quinazolin-4-yl]amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19779310 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[4-[[[2-(butylamino)quinazolin-4-yl]amino]methyl]phenyl]benzoic acid |
| SMILES | CCCCNc1nc(NCc2ccc(-c3ccccc3C(=O)O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H26N4O2/c1-2-3-16-27-26-29-23-11-7-6-10-22(23)24(30-26)28-17-18-12-14-19(15-13-18)20-8-4-5-9-21(20)25(31)32/h4-15H,2-3,16-17H2,1H3,(H,31,32)(H2,27,28,29,30) |
| InChIKey | DTZLHYIYMWNPKI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|