C16H18N4S — CID 80813725
2-N-propyl-4-N-(thiophen-3-ylmethyl)quinazoline-2,4-diamine (PubChem CID 80813725) has the molecular formula C16H18N4S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-N-propyl-4-N-(thiophen-3-ylmethyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-propyl-4-N-(thiophen-3-ylmethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 80813725 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-N-propyl-4-N-(thiophen-3-ylmethyl)quinazoline-2,4-diamine |
| SMILES | CCCNc1nc(NCc2ccsc2)c2ccccc2n1 |
| InChI | InChI=1S/C16H18N4S/c1-2-8-17-16-19-14-6-4-3-5-13(14)15(20-16)18-10-12-7-9-21-11-12/h3-7,9,11H,2,8,10H2,1H3,(H2,17,18,19,20) |
| InChIKey | PRASFMLKKGZINZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |