C20H24N4O — CID 91966285
2-N-[2-(3-methoxyphenyl)ethyl]-4-N-propylquinazoline-2,4-diamine (PubChem CID 91966285) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-N-[2-(3-methoxyphenyl)ethyl]-4-N-propylquinazoline-2,4-diamine.
| Compound Name | 2-N-[2-(3-methoxyphenyl)ethyl]-4-N-propylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 91966285 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-N-[2-(3-methoxyphenyl)ethyl]-4-N-propylquinazoline-2,4-diamine |
| SMILES | CCCNc1nc(NCCc2cccc(OC)c2)nc2ccccc12 |
| InChI | InChI=1S/C20H24N4O/c1-3-12-21-19-17-9-4-5-10-18(17)23-20(24-19)22-13-11-15-7-6-8-16(14-15)25-2/h4-10,14H,3,11-13H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | OXWJZBIWUSNCGD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |