C26H23NO3 — CID 11741515
2-[4-[(2-propylquinolin-4-yl)oxymethyl]phenyl]benzoic acid (PubChem CID 11741515) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[4-[(2-propylquinolin-4-yl)oxymethyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(2-propylquinolin-4-yl)oxymethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 11741515 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[4-[(2-propylquinolin-4-yl)oxymethyl]phenyl]benzoic acid |
| SMILES | CCCc1cc(OCc2ccc(-c3ccccc3C(=O)O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C26H23NO3/c1-2-7-20-16-25(23-10-5-6-11-24(23)27-20)30-17-18-12-14-19(15-13-18)21-8-3-4-9-22(21)26(28)29/h3-6,8-16H,2,7,17H2,1H3,(H,28,29) |
| InChIKey | NOBNOIVDXOQHJK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |