C26H28O4 — CID 118026037
5-pentyl-2,3-bis(phenylmethoxy)benzoic acid (PubChem CID 118026037) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 5-pentyl-2,3-bis(phenylmethoxy)benzoic acid.
| Compound Name | 5-pentyl-2,3-bis(phenylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 118026037 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 5-pentyl-2,3-bis(phenylmethoxy)benzoic acid |
| SMILES | CCCCCc1cc(OCc2ccccc2)c(OCc2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H28O4/c1-2-3-6-15-22-16-23(26(27)28)25(30-19-21-13-9-5-10-14-21)24(17-22)29-18-20-11-7-4-8-12-20/h4-5,7-14,16-17H,2-3,6,15,18-19H2,1H3,(H,27,28) |
| InChIKey | UCLIHFOWSQLQQO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|