C15H21N5O — CID 106241710
5-[[2-(ethylamino)quinazolin-4-yl]amino]pentanamide (PubChem CID 106241710) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 5-[[2-(ethylamino)quinazolin-4-yl]amino]pentanamide.
| Compound Name | 5-[[2-(ethylamino)quinazolin-4-yl]amino]pentanamide |
|---|---|
| PubChem CID | 106241710 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 5-[[2-(ethylamino)quinazolin-4-yl]amino]pentanamide |
| SMILES | CCNc1nc(NCCCCC(N)=O)c2ccccc2n1 |
| InChI | InChI=1S/C15H21N5O/c1-2-17-15-19-12-8-4-3-7-11(12)14(20-15)18-10-6-5-9-13(16)21/h3-4,7-8H,2,5-6,9-10H2,1H3,(H2,16,21)(H2,17,18,19,20) |
| InChIKey | WGBSEOMKBGEUKD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|