C22H23ClN2O — CID 43860369
4-tert-butyl-N-(7-chloro-2,8-dimethylquinolin-4-yl)benzamide (PubChem CID 43860369) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-tert-butyl-N-(7-chloro-2,8-dimethylquinolin-4-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(7-chloro-2,8-dimethylquinolin-4-yl)benzamide |
|---|---|
| PubChem CID | 43860369 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-tert-butyl-N-(7-chloro-2,8-dimethylquinolin-4-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(C(C)(C)C)cc2)c2ccc(Cl)c(C)c2n1 |
| InChI | InChI=1S/C22H23ClN2O/c1-13-12-19(17-10-11-18(23)14(2)20(17)24-13)25-21(26)15-6-8-16(9-7-15)22(3,4)5/h6-12H,1-5H3,(H,24,25,26) |
| InChIKey | FTWTXISMNQEMOJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |