C14H18ClN — CID 170974379
7-chloro-2,4,8-trimethylquinoline;ethane (PubChem CID 170974379) has the molecular formula C14H18ClN and a molecular weight of 235.76 g/mol. Its IUPAC name is 7-chloro-2,4,8-trimethylquinoline;ethane.
| Compound Name | 7-chloro-2,4,8-trimethylquinoline;ethane |
|---|---|
| PubChem CID | 170974379 |
| Molecular Formula | C14H18ClN |
| Molecular Weight | 235.76 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 7-chloro-2,4,8-trimethylquinoline;ethane |
| SMILES | CC.Cc1cc(C)c2ccc(Cl)c(C)c2n1 |
| InChI | InChI=1S/C12H12ClN.C2H6/c1-7-6-8(2)14-12-9(3)11(13)5-4-10(7)12;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | SKPDNXWKZRNBHQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |