C12H9Cl2NO2 — CID 84641441
2,7-dichloro-4,8-dimethylquinoline-3-carboxylic acid (PubChem CID 84641441) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is 2,7-dichloro-4,8-dimethylquinoline-3-carboxylic acid.
| Compound Name | 2,7-dichloro-4,8-dimethylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 84641441 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 2,7-dichloro-4,8-dimethylquinoline-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(Cl)nc2c(C)c(Cl)ccc12 |
| InChI | InChI=1S/C12H9Cl2NO2/c1-5-7-3-4-8(13)6(2)10(7)15-11(14)9(5)12(16)17/h3-4H,1-2H3,(H,16,17) |
| InChIKey | AJIIUTCTJDCRIH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|