C15H16ClNO2 — CID 84642426
2-(7-chloro-4,8-dimethylquinolin-2-yl)-2-methylpropanoic acid (PubChem CID 84642426) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-(7-chloro-4,8-dimethylquinolin-2-yl)-2-methylpropanoic acid.
| Compound Name | 2-(7-chloro-4,8-dimethylquinolin-2-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 84642426 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-(7-chloro-4,8-dimethylquinolin-2-yl)-2-methylpropanoic acid |
| SMILES | Cc1cc(C(C)(C)C(=O)O)nc2c(C)c(Cl)ccc12 |
| InChI | InChI=1S/C15H16ClNO2/c1-8-7-12(15(3,4)14(18)19)17-13-9(2)11(16)6-5-10(8)13/h5-7H,1-4H3,(H,18,19) |
| InChIKey | QRZAAUQZUSHNLW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |