C13H11ClN2 — CID 84626490
2-(7-chloro-4,8-dimethylquinolin-2-yl)acetonitrile (PubChem CID 84626490) has the molecular formula C13H11ClN2 and a molecular weight of 230.70 g/mol. Its IUPAC name is 2-(7-chloro-4,8-dimethylquinolin-2-yl)acetonitrile.
| Compound Name | 2-(7-chloro-4,8-dimethylquinolin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 84626490 |
| Molecular Formula | C13H11ClN2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(7-chloro-4,8-dimethylquinolin-2-yl)acetonitrile |
| SMILES | Cc1cc(CC#N)nc2c(C)c(Cl)ccc12 |
| InChI | InChI=1S/C13H11ClN2/c1-8-7-10(5-6-15)16-13-9(2)12(14)4-3-11(8)13/h3-4,7H,5H2,1-2H3 |
| InChIKey | WUWONFRVSAYOED-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |