C15H9Cl2NO2S — CID 4016668
7-chloro-2-(5-chlorothiophen-2-yl)-8-methylquinoline-4-carboxylic acid (PubChem CID 4016668) has the molecular formula C15H9Cl2NO2S and a molecular weight of 338.22 g/mol. Its IUPAC name is 7-chloro-2-(5-chlorothiophen-2-yl)-8-methylquinoline-4-carboxylic acid.
| Compound Name | 7-chloro-2-(5-chlorothiophen-2-yl)-8-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4016668 |
| Molecular Formula | C15H9Cl2NO2S |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 7-chloro-2-(5-chlorothiophen-2-yl)-8-methylquinoline-4-carboxylic acid |
| SMILES | Cc1c(Cl)ccc2c(C(=O)O)cc(-c3ccc(Cl)s3)nc12 |
| InChI | InChI=1S/C15H9Cl2NO2S/c1-7-10(16)3-2-8-9(15(19)20)6-11(18-14(7)8)12-4-5-13(17)21-12/h2-6H,1H3,(H,19,20) |
| InChIKey | MJFBJMKOBCFSFU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |