C15H19ClN2O — CID 82449491
N-[(7-chloro-2,8-dimethylquinolin-4-yl)methyl]-2-methoxyethanamine (PubChem CID 82449491) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is N-[(7-chloro-2,8-dimethylquinolin-4-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(7-chloro-2,8-dimethylquinolin-4-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 82449491 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[(7-chloro-2,8-dimethylquinolin-4-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(C)nc2c(C)c(Cl)ccc12 |
| InChI | InChI=1S/C15H19ClN2O/c1-10-8-12(9-17-6-7-19-3)13-4-5-14(16)11(2)15(13)18-10/h4-5,8,17H,6-7,9H2,1-3H3 |
| InChIKey | AYUXYYTXCCFJIQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|