C12H13ClFNO2 — CID 116691026
N-[(6-chloro-7-fluoro-1-benzofuran-3-yl)methyl]-2-methoxyethanamine (PubChem CID 116691026) has the molecular formula C12H13ClFNO2 and a molecular weight of 257.69 g/mol. Its IUPAC name is N-[(6-chloro-7-fluoro-1-benzofuran-3-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(6-chloro-7-fluoro-1-benzofuran-3-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 116691026 |
| Molecular Formula | C12H13ClFNO2 |
| Molecular Weight | 257.69 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | N-[(6-chloro-7-fluoro-1-benzofuran-3-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1coc2c(F)c(Cl)ccc12 |
| InChI | InChI=1S/C12H13ClFNO2/c1-16-5-4-15-6-8-7-17-12-9(8)2-3-10(13)11(12)14/h2-3,7,15H,4-6H2,1H3 |
| InChIKey | KKPQQMITRHIVMY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|