C13H20ClFN2O — CID 113410553
N'-[(2-chloro-3-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine (PubChem CID 113410553) has the molecular formula C13H20ClFN2O and a molecular weight of 274.77 g/mol. Its IUPAC name is N'-[(2-chloro-3-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine.
| Compound Name | N'-[(2-chloro-3-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 113410553 |
| Molecular Formula | C13H20ClFN2O |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N'-[(2-chloro-3-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine |
| SMILES | COCCNCCCNCc1cccc(F)c1Cl |
| InChI | InChI=1S/C13H20ClFN2O/c1-18-9-8-16-6-3-7-17-10-11-4-2-5-12(15)13(11)14/h2,4-5,16-17H,3,6-10H2,1H3 |
| InChIKey | ABWLTMIMLAKZLA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|