C13H21FN2O — CID 113410575
N'-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine (PubChem CID 113410575) has the molecular formula C13H21FN2O and a molecular weight of 240.32 g/mol. Its IUPAC name is N'-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine.
| Compound Name | N'-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 113410575 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N'-[(2-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine |
| SMILES | COCCNCCCNCc1ccccc1F |
| InChI | InChI=1S/C13H21FN2O/c1-17-10-9-15-7-4-8-16-11-12-5-2-3-6-13(12)14/h2-3,5-6,15-16H,4,7-11H2,1H3 |
| InChIKey | AVWGRDOENCBLAG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|