C13H20BrFN2O — CID 114019833
N'-[(3-bromo-2-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine (PubChem CID 114019833) has the molecular formula C13H20BrFN2O and a molecular weight of 319.22 g/mol. Its IUPAC name is N'-[(3-bromo-2-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine.
| Compound Name | N'-[(3-bromo-2-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114019833 |
| Molecular Formula | C13H20BrFN2O |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N'-[(3-bromo-2-fluorophenyl)methyl]-N-(2-methoxyethyl)propane-1,3-diamine |
| SMILES | COCCNCCCNCc1cccc(Br)c1F |
| InChI | InChI=1S/C13H20BrFN2O/c1-18-9-8-16-6-3-7-17-10-11-4-2-5-12(14)13(11)15/h2,4-5,16-17H,3,6-10H2,1H3 |
| InChIKey | NWXYQKSBSANPNM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|