C12H18BrFN2O — CID 113405507
N'-[(2-bromo-3-fluorophenyl)methyl]-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 113405507) has the molecular formula C12H18BrFN2O and a molecular weight of 305.19 g/mol. Its IUPAC name is N'-[(2-bromo-3-fluorophenyl)methyl]-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N'-[(2-bromo-3-fluorophenyl)methyl]-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 113405507 |
| Molecular Formula | C12H18BrFN2O |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N'-[(2-bromo-3-fluorophenyl)methyl]-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | COCCNCCNCc1cccc(F)c1Br |
| InChI | InChI=1S/C12H18BrFN2O/c1-17-8-7-15-5-6-16-9-10-3-2-4-11(14)12(10)13/h2-4,15-16H,5-9H2,1H3 |
| InChIKey | JYOHCTUWBKGKJR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|