C16H17F2NO2 — CID 63070603
N-[[2-(2,3-difluorophenoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 63070603) has the molecular formula C16H17F2NO2 and a molecular weight of 293.31 g/mol. Its IUPAC name is N-[[2-(2,3-difluorophenoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-(2,3-difluorophenoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63070603 |
| Molecular Formula | C16H17F2NO2 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[[2-(2,3-difluorophenoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccccc1Oc1cccc(F)c1F |
| InChI | InChI=1S/C16H17F2NO2/c1-20-10-9-19-11-12-5-2-3-7-14(12)21-15-8-4-6-13(17)16(15)18/h2-8,19H,9-11H2,1H3 |
| InChIKey | ZNGKECFMZIVJGI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|