C15H16F2N2O — CID 81250606
N-[[4-(2,3-difluorophenoxy)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 81250606) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is N-[[4-(2,3-difluorophenoxy)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(2,3-difluorophenoxy)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81250606 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[[4-(2,3-difluorophenoxy)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnccc1Oc1cccc(F)c1F |
| InChI | InChI=1S/C15H16F2N2O/c1-2-7-18-9-11-10-19-8-6-13(11)20-14-5-3-4-12(16)15(14)17/h3-6,8,10,18H,2,7,9H2,1H3 |
| InChIKey | GTZNIXDTUWSTOK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|