C14H15F2N3O — CID 107382115
N-[[5-(2,3-difluorophenoxy)pyrazin-2-yl]methyl]propan-1-amine (PubChem CID 107382115) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is N-[[5-(2,3-difluorophenoxy)pyrazin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2,3-difluorophenoxy)pyrazin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107382115 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[[5-(2,3-difluorophenoxy)pyrazin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(Oc2cccc(F)c2F)cn1 |
| InChI | InChI=1S/C14H15F2N3O/c1-2-6-17-7-10-8-19-13(9-18-10)20-12-5-3-4-11(15)14(12)16/h3-5,8-9,17H,2,6-7H2,1H3 |
| InChIKey | ZTLVZZQPMQZXDM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|