C15H19N3O3 — CID 107381670
N-[[5-(2,6-dimethoxyphenoxy)pyrazin-2-yl]methyl]ethanamine (PubChem CID 107381670) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[[5-(2,6-dimethoxyphenoxy)pyrazin-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(2,6-dimethoxyphenoxy)pyrazin-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 107381670 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[[5-(2,6-dimethoxyphenoxy)pyrazin-2-yl]methyl]ethanamine |
| SMILES | CCNCc1cnc(Oc2c(OC)cccc2OC)cn1 |
| InChI | InChI=1S/C15H19N3O3/c1-4-16-8-11-9-18-14(10-17-11)21-15-12(19-2)6-5-7-13(15)20-3/h5-7,9-10,16H,4,8H2,1-3H3 |
| InChIKey | WJYGEAMGLMRTAJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |