C13H13Cl2N3O — CID 107381649
N-[[5-(2,3-dichlorophenoxy)pyrazin-2-yl]methyl]ethanamine (PubChem CID 107381649) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is N-[[5-(2,3-dichlorophenoxy)pyrazin-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(2,3-dichlorophenoxy)pyrazin-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 107381649 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[[5-(2,3-dichlorophenoxy)pyrazin-2-yl]methyl]ethanamine |
| SMILES | CCNCc1cnc(Oc2cccc(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C13H13Cl2N3O/c1-2-16-6-9-7-18-12(8-17-9)19-11-5-3-4-10(14)13(11)15/h3-5,7-8,16H,2,6H2,1H3 |
| InChIKey | CRLXXMOSOMTQPF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |