C13H19BrFNO2 — CID 106255103
1-[(2-bromo-3-fluorophenyl)methylamino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 106255103) has the molecular formula C13H19BrFNO2 and a molecular weight of 320.20 g/mol. Its IUPAC name is 1-[(2-bromo-3-fluorophenyl)methylamino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[(2-bromo-3-fluorophenyl)methylamino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106255103 |
| Molecular Formula | C13H19BrFNO2 |
| Molecular Weight | 320.20 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-[(2-bromo-3-fluorophenyl)methylamino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNCc1cccc(F)c1Br |
| InChI | InChI=1S/C13H19BrFNO2/c1-13(17,6-7-18-2)9-16-8-10-4-3-5-11(15)12(10)14/h3-5,16-17H,6-9H2,1-2H3 |
| InChIKey | WHPCMHUSPXDHGB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |