C13H19BrClNO2 — CID 113244921
1-[(2-bromo-5-chlorophenyl)methylamino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 113244921) has the molecular formula C13H19BrClNO2 and a molecular weight of 336.66 g/mol. Its IUPAC name is 1-[(2-bromo-5-chlorophenyl)methylamino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[(2-bromo-5-chlorophenyl)methylamino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 113244921 |
| Molecular Formula | C13H19BrClNO2 |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 1-[(2-bromo-5-chlorophenyl)methylamino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNCc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C13H19BrClNO2/c1-13(17,5-6-18-2)9-16-8-10-7-11(15)3-4-12(10)14/h3-4,7,16-17H,5-6,8-9H2,1-2H3 |
| InChIKey | VAWZTPZZNSRGOB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |