C12H16BrFN2O — CID 106276675
3-[(2-bromo-3-fluorophenyl)methylamino]-2,2-dimethylpropanamide (PubChem CID 106276675) has the molecular formula C12H16BrFN2O and a molecular weight of 303.17 g/mol. Its IUPAC name is 3-[(2-bromo-3-fluorophenyl)methylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(2-bromo-3-fluorophenyl)methylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106276675 |
| Molecular Formula | C12H16BrFN2O |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-[(2-bromo-3-fluorophenyl)methylamino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNCc1cccc(F)c1Br)C(N)=O |
| InChI | InChI=1S/C12H16BrFN2O/c1-12(2,11(15)17)7-16-6-8-4-3-5-9(14)10(8)13/h3-5,16H,6-7H2,1-2H3,(H2,15,17) |
| InChIKey | COXSUUCMPWRPRM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |