C12H19ClN2O2 — CID 115603008
3-[(2-hydroxyphenyl)methylamino]-2,2-dimethylpropanamide;hydrochloride (PubChem CID 115603008) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 3-[(2-hydroxyphenyl)methylamino]-2,2-dimethylpropanamide;hydrochloride.
| Compound Name | 3-[(2-hydroxyphenyl)methylamino]-2,2-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 115603008 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-[(2-hydroxyphenyl)methylamino]-2,2-dimethylpropanamide;hydrochloride |
| SMILES | CC(C)(CNCc1ccccc1O)C(N)=O.Cl |
| InChI | InChI=1S/C12H18N2O2.ClH/c1-12(2,11(13)16)8-14-7-9-5-3-4-6-10(9)15;/h3-6,14-15H,7-8H2,1-2H3,(H2,13,16);1H |
| InChIKey | CDWYGKFQYKWPGP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|