C13H18F2N2O — CID 113383872
3-[1-(2,6-difluorophenyl)ethylamino]-2,2-dimethylpropanamide (PubChem CID 113383872) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-[1-(2,6-difluorophenyl)ethylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[1-(2,6-difluorophenyl)ethylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 113383872 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-[1-(2,6-difluorophenyl)ethylamino]-2,2-dimethylpropanamide |
| SMILES | CC(NCC(C)(C)C(N)=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H18F2N2O/c1-8(17-7-13(2,3)12(16)18)11-9(14)5-4-6-10(11)15/h4-6,8,17H,7H2,1-3H3,(H2,16,18) |
| InChIKey | FRGBYDQKXMKFFM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |